Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2,6-dichlorophenylacetic acid

Inventory

EC number:
229-504-0
EC name:
2,6-dichlorophenylacetic acid
CAS number:
6575-24-2
CAS number:
6575-24-2
Synonyms
Names:
2,6-dichlorophenylacetic acid

Molecular and structural information

Molecular formula:
Cl2C6H3CH2CO2H
Molecular weight:
ca. 205.04
SMILES notation:
C1=CC(=C(C(=C1)Cl)CC(=O)O)Cl
Structural formula:
Chemical structure

Related substances