Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1,3-phenylenebis(propane-2,2-diylcarbamoyloxyethane-2,1-diyl) bis(2-methylacrylate)


CAS number:


Molecular and structural information

Molecular formula:
Molecular weight:
SMILES notation:
C=C(C)C(=O)OCCOC(=O)NC(C)(C)c1cccc(C(C)(C)NC(=O)OCCOC(=O)C(C)=C)c1 or C=C(C)C(=O)OCCOC(=O)NC(C)(C)c1cc(C(C)(C)NC(=O)OCCOC(=O)C(C)=C)ccc1
Structural formula:
Chemical structure

Related substances