Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
lauric acid

Inventory

EC number:
205-582-1
EC name:
Lauric acid
CAS number:
143-07-7
CAS number:
143-07-7
Synonyms
Names:
Dodecanoic acid

Molecular and structural information

Molecular formula:
C12H24O2
Molecular weight:
200.318
SMILES notation:
CCCCCCCCCCCC(=O)O
InChl:
InChI=1/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)
Structural formula:
Chemical structure

Related substances