Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-methylpropanoic acid

Inventory

EC number:
201-195-7
EC name:
Isobutyric acid
CAS number:
79-31-2
CAS number:
79-31-2
Synonyms
Names:
Propanoic acid, 2-methyl-
2-methylpropanoic acid

Molecular and structural information

Molecular formula:
C4H8O2
Molecular weight:
88.105
SMILES notation:
CC(C)C(=O)O
InChl:
InChI=1/C4H8O2/c1-3(2)4(5)6/h3H,1-2H3,(H,5,6)
Structural formula:
Chemical structure

Related substances