Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
(9E,12E)-N-[2-({2-[(2-aminoethyl)(2-{[(10E)-octadec-10-enoyl]amino}ethyl)amino]ethyl}amino)ethyl]octadeca-9,12-dienamide

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C10H21N5O2; R1 = R2 = C17H31 and C17H33
Molecular weight:
ca. 716
SMILES notation:
desgin as R1=R2 = C17H33 and C17H31
CCCCC\C=C\C\C=C\CCCCCCCC(=O)NCCNCCN(CCNC(=O)CCCCCCCC\C=C\CCCCCCC)CCN
InChl:
InChI=1S/C44H85N5O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-43(50)47-37-36-46-38-41-49(40-35-45)42-39-48-44(51)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,16-19,46H,3-10,12,14-15,20-42,45H2,1-2H3,(H,47,50)(H,48,51)/b13-11+,18-16+,19-17+
Structural formula:
Chemical structure

Related substances