Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
(9Z)-N-[2-({2-[(2-aminoethyl)amino]ethyl}amino)ethyl]octadec-9-enamide

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C24H50N4O
Molecular weight:
410.7
SMILES notation:
CCCCCCCC\C=C/CCCCCCCC(=O)NCCNCCNCCN
Structural formula:
Chemical structure

Related substances