Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
16-methylheptadecanoic acid

Inventory

EC number:
220-336-3
EC name:
16-methylheptadecanoic acid
CAS number:
2724-58-5
CAS number:
2724-58-5

Synonyms

Molecular and structural information

Molecular formula:
C18H36O2
Molecular weight:
284.477
SMILES notation:
CC(C)CCCCCCCCCCCCCCC(=O)O
InChl:
InChI=1/C18H36O2/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20/h17H,3-16H2,1-2H3,(H,19,20)
Structural formula:
Chemical structure

Related substances