Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
not known

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C24H22N2O
Molecular weight:
354.44
SMILES notation:
C1ccccc1NC=2C\C(=C/C(C=2)Oc3ccccc3)Nc4ccccc4
Structural formula:
Chemical structure

Related substances