Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1,3-benzodioxol-5-ylacetonitrile

Inventory

EC number:
224-655-9
EC name:
3,4-(methylenedioxy)phenylacetonitrile
CAS number:
4439-02-5
CAS number:
4439-02-5
Synonyms
Names:
3,4-(methylenedioxy)phenylacetonitrile

Molecular and structural information

Molecular formula:
C9H7NO2
Molecular weight:
161.157
SMILES notation:
N#CCc1ccc2OCOc2c1
InChl:
InChI=1/C9H7NO2/c10-4-3-7-1-2-8-9(5-7)12-6-11-8/h1-2,5H,3,6H2
Structural formula:
Chemical structure

Related substances