Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
sodium naphthalene-1-sulfonate

Inventory

Synonyms

Molecular and structural information

Molecular formula:
= C10H7NaO3S
Molecular weight:
230
SMILES notation:
[Na+].[O-]S(=O)(=O)c2cccc1ccccc12
Structural formula:
Chemical structure

Related substances