Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
sodium 4-(4,6-dimethylheptan-2-yl)-6,7-dimethylnaphthalene-1-sulfonate

Inventory

Synonyms

Molecular and structural information

Molecular formula:
= C21H29NaO3S
Molecular weight:
384
SMILES notation:
[Na+].CC(C)CC(C)CC(C)c1ccc(c2cc(C)c(C)cc12)S([O-])(=O)=O
Structural formula:
Chemical structure

Related substances