Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-chloroethyldimethylammonium chloride

Inventory

EC number:
224-970-1
EC name:
2-chloroethyldimethylammonium chloride
CAS number:
4584-46-7
CAS number:
4584-46-7
Synonyms
Names:
Ethanamine, 2-chloro-N,N-dimethyl-, hydrochloride
N,N-(dimethylamino)ethyl chloride
2-chloro-N,N-dimethylethanaminium chloride

Molecular and structural information

Molecular formula:
C4H10ClN.ClH
Molecular weight:
144.043
SMILES notation:
[Cl-].C[NH+](C)CCCl
InChl:
InChI=1/C4H10ClN.ClH/c1-6(2)4-3-5;/h3-4H2,1-2H3;1H
Structural formula:
Chemical structure

Related substances

Categories Display