Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1,2-dimethyl-4-(1-phenylethyl)benzene

Inventory

EC number:
228-249-2
EC name:
4-(1-phenylethyl)-o-xylene
CAS number:
6196-95-8
CAS number:
6196-95-8
Synonyms
Names:
Benzene, 1,2-dimethyl-4-(1-phenylethyl)-

Molecular and structural information

Molecular formula:
C16H18
Molecular weight:
210.314
SMILES notation:
CC(c1ccccc1)c2ccc(C)c(C)c2
InChl:
InChI=1/C16H18/c1-12-9-10-16(11-13(12)2)14(3)15-7-5-4-6-8-15/h4-11,14H,1-3H3
Structural formula:
Chemical structure

Related substances