Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3,5-diamino-2,4,6-triiodobenzoic acid

Inventory

EC number:
226-845-7
EC name:
3,5-diamino-2,4,6-triiodobenzoic acid
CAS number:
5505-16-8
CAS number:
5505-16-8
Synonyms
Names:
3,5-diamino-2,4,6-triiodobenzoic_acid
3,5-diamino-2,4,6-triiodobenzoic acid

Molecular and structural information

Molecular formula:
C7H5I3N2O2
Molecular weight:
529.84
SMILES notation:
Nc1c(I)c(N)c(I)c(C(=O)O)c1I
InChl:
InChI=1/C7H5I3N2O2/c8-2-1(7(13)14)3(9)6(12)4(10)5(2)11/h11-12H2,(H,13,14)
Structural formula:
Chemical structure

Related substances