Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
6-aminonaphthalene-2-sulfonic acid

Inventory

EC number:
202-208-9
EC name:
6-aminonaphthalene-2-sulphonic acid
CAS number:
93-00-5
CAS number:
93-00-5

Synonyms

Molecular and structural information

Molecular formula:
C10H9NO3S
Molecular weight:
223.248
SMILES notation:
Nc1ccc2cc(ccc2c1)S(=O)(=O)O
InChl:
1/C10H9NO3S/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9/h1-6H,11H2,(H,12,13,14)
Structural formula:
Chemical structure

Related substances