Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,4,6-trimethylbenzoic acid

Inventory

EC number:
207-553-9
EC name:
2,4,6-trimethylbenzoic acid
CAS number:
480-63-7
CAS number:
480-63-7

Synonyms

Molecular and structural information

Molecular formula:
C10H12O2
Molecular weight:
164.201
SMILES notation:
Cc1cc(C)c(C(=O)O)c(C)c1
InChl:
InChI=1/C10H12O2/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3,(H,11,12)
Structural formula:
Chemical structure

Related substances