Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,6-di-tert-butyl-4-[(dimethylamino)methyl]phenol

Inventory

EC number:
201-816-1
EC name:
2,6-di-tert-butyl-α-dimethylamino-p-cresol
CAS number:
88-27-7
CAS number:
88-27-7
Synonyms
Names:
Phenol, 4-[(dimethylamino)methyl] -2,6-bis(1,1-dimethylethyl)-
Phenol, 4-[(dimethylamino)methyl]-2,6-bis(1,1-dimethylethyl)-
p-Cresol, 2,6-di-tert-butyl-.alpha.-(dimethylamino)-
Identifier:
other:
2,6-di-tert-butyl-4-[(dimethylamino)methyl]phenol
Identifier:
other:
Phenol, 4-[(dimethylamino)methyl] -2,6-bis(1,1-dimethylethyl)-
Identifier:
other:
Phenol, 4-[(dimethylamino)methyl]-2,6-bis(1,1-dimethylethyl)-
Identifier:
other:
p-Cresol, 2,6-di-tert-butyl-.alpha.-(dimethylamino)-
2,6-di-tert-butyl-4-[(dimethylamino)methyl]phenol

Molecular and structural information

Molecular formula:
C17H29NO
Molecular weight:
263.418
SMILES notation:
CN(C)Cc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C
InChl:
InChI=1/C17H29NO/c1-16(2,3)13-9-12(11-18(7)8)10-14(15(13)19)17(4,5)6/h9-10,19H,11H2,1-8H3
Structural formula:
Chemical structure

Related substances