Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
5,5'-(1H-isoindole-1,3(2H)-diylidene)dipyrimidine-2,4,6(1H,3H,5H)-trione

Inventory

EC number:
253-256-2
EC name:
5,5'-(1H-isoindole-1,3(2H)-diylidene)dibarbituric acid
CAS number:
36888-99-0
CAS number:
36888-99-0

Synonyms

Molecular and structural information

Molecular formula:
C16H9N5O6
Molecular weight:
367.273
SMILES notation:
O=C1NC(=O)C(=C2NC(=C3C(=O)NC(=O)NC3=O)c4ccccc24)C(=O)N1
InChl:
InChI=1/C16H9N5O6/c22-11-7(12(23)19-15(26)18-11)9-5-3-1-2-4-6(5)10(17-9)8-13(24)20-16(27)21-14(8)25/h1-4,17H,(H2,18,19,22,23,26)(H2,20,21,24,25,27)
Structural formula:
Chemical structure

Related substances