Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
4-amino-5-hydroxynaphthalene-1,7-disulfonic acid

Inventory

EC number:
204-982-3
EC name:
4-amino-5-hydroxynaphthalene-1,7-disulphonic acid
CAS number:
130-23-4
CAS number:
130-23-4
Synonyms
Names:
1,7-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-

Molecular and structural information

Molecular formula:
C10H9NO7S2
Molecular weight:
319.311
SMILES notation:
Nc1ccc(c2cc(cc(O)c12)S(=O)(=O)O)S(=O)(=O)O
InChl:
InChI=1/C10H9NO7S2/c11-7-1-2-9(20(16,17)18)6-3-5(19(13,14)15)4-8(12)10(6)7/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18)
Structural formula:
Chemical structure

Related substances