Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,2'-(butane-2,2-diyldidioxy)bis(2-methylbutane)

Inventory

EC number:
237-136-7
EC name:
(1-methylpropylidene)bis[tert-butyl] peroxide
CAS number:
13653-62-8
CAS number:
13653-62-8
Synonyms
Names:
Identifier:
EC name
(1-methylpropylidene)bis[tert-butyl]_peroxide
Identifier:
ChemSpider ID
75460
Identifier:
common name
2,2-Bis(tert-amylperoxy)butane
Identifier:
common name
2,2-Di-tert-amylperoxybutane

Molecular and structural information

Molecular formula:
C14H30O4
Molecular weight:
ca. 262.39
SMILES notation:
CCC(C)(C)OOC(C)(CC)OOC(C)(C)CC
InChl:
InChI=1/C14H30O4/c1-9-12(4,5)15-17-14(8,11-3)18-16-13(6,7)10-2/h9-11H2,1-8H3
Structural formula:
Chemical structure

Related substances