- ECHA
- Consultations
- Harmonised classification and labelling consultations
- Harmonised classification and labelling previous consultations
Harmonised classification and labelling previous consultations
Several consultations on the proposed harmonised classifications and labelling for a number of substances have already taken place and have now been closed. These substances are listed in the table below together with the CLH proposals. The comments received during the consultation, along with the non-confidential attachments, are available on the Registry of CLH intentions until outcome.
After finalising the consultation, the proposals, together with the comments received, will be discussed by ECHA's Risk Assessment Committee, which will issue a scientific opinion on the proposal.
All documentation will be submitted to the European Commission which in the end will decide on the classification. Any new classifications will be included in the list of harmonised classifications (Annex VI to the CLP Regulation) and will also be published on ECHA's website.
Difenacoum (ISO),3-(3-biphenyl-4-yl-1,2,3,4-tetrahydro-1- naphthyl)-4-hydroxycoumarin | 259-978-4 | 56073-07-5 | 19/04/2013 | |
difenoconazole (ISO); 1-({2-[2-chloro-4-(4-chlorophenoxy)phenyl]-4-methyl-1,3-dioxolan-2-yl}methyl)-1H-1,2,4-triazole; 3-chloro-4-[(2RS,4RS;2RS,4SR)-4-methyl-2-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]phenyl 4-chlorophenyl ether | 601-613-1 | 119446-68-3 | 01/06/2020 | |
Difethialone (ISO),3-[3-(4'-bromobiphenyl-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-hydroxy-2H-1-benzothiopyran-2-one | - | 104653-34-1 | 19/04/2013 | |
diflufenican (ISO); N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]-3-pyridinecarboxamide; 2′,4′-difluoro-2-(α,α,α-trifluoro-m-tolyloxy) nicotinanilide | - | 83164-33-4 | 07/12/2018 | |
diisobutyl phthalate | 201-553-2 | 84-69-5 | 09/05/2014 | |
diisohexyl phthalate | 276-090-2 | 71850-09-4 | 30/09/2016 | |
Diisohexyl phthalate (DIHP) | 271-093-5 | 68515-50-4 | 21/09/2012 | |
diisooctyl phthalate | 248-523-5 | 27554-26-3 | 28/04/2017 | |
Dimethenamid-P | - | 163515-14-8 | 07/12/2012 | |
dimethomorph (ISO); (E,Z)-4-(3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)acryloyl)morpholine | 404-200-2 | 110488-70-5 | 08/03/2019 | |
Dimethyl disulphide | 210-871-0 | 624-92-0 | 07/07/2017 | |
Dimethyl propylphosphonate | 242-555-3 | 18755-43-6 | 23/10/2020 | |
Dimethyltin bis(2-ethylhexylmercaptoacetate), DMT (EHMA) | 260-829-0 | 57583-35-4 | 30/03/2012 | |
Dimethyltin dichloride (DMTC) | 212-039-2 | 753-73-1 | 30/03/2012 | |
dimoxystrobin (ISO); (2E)-2-{2-[(2,5-dimethylphenoxy)methyl]phenyl}-2-(methoxyimino)-N-methylacetamide; (E)-2-(methoxyimino)-N-methyl-2-[a-(2,5-xylyloxy)-o-tolyl]acetamide | - | 149961-52-4 | 30/08/2019 | |
Dioctyltin bis(2-ethylhexyl mercaptoacetate), 2-Ethylhexyl 10-ethyl-4,4- dioctyl-7-oxo-8-oxa-3,5-dithia- 4-stannatetradecanoate | 239-622-4 | 15571-58-1 | 09/05/2011 | |
dioctyltin dilaurate; [1] stannane, dioctyl-, bis(coco acyloxy) derivs. [2] |
222-883-3 293-901-5 | 3648-18-8 91648-39-4 | 01/12/2017 | |
Diphenyl(2,4,6-trimethylbenzoyl)phosphine oxide | 278-355-8 | 75980-60-8 | 14/05/2010 | |
Diphenyl(2,4,6-trimethylbenzoyl)phosphine oxide | 278-355-8 | 75980-60-8 | 23/10/2020 | |
disodium 4-amino-6-((4-((4-(2,4-diaminophenyl)azo)phenylsulfamoyl)phenyl)azo)-5-hydroxy-3-((4-nitrophenyl)azo)naphthalene-2,7-disulfonate | 421-880-6 | 201792-73-6 | 16/01/2017 | |
Disodium Octaborate Tetrahydrate | 234-541-0 | 12280-03-4 | 14/06/2013 | |
disodium octaborate, anhydrate | 234-541-0 | 12008-41-2 | 14/06/2013 | |
diuron (ISO); 3-(3,4-dichlorophenyl)-1,1-dimethylurea | 206-354-4 | 330-54-1 | 31/07/2020 | |
divanadium pentaoxide; vanadium pentoxide | 215-239-8 | 1314-62-1 | 22/11/2019 | |
dodecyl methacrylate | 205-570-6 | 142-90-5 | 19/12/2016 | |
Dodemorph | 216-474-9 | 1593-77-7 | 01/02/2013 | |
Dodemorph acetate | 250-778-2 | 31717-87-0 | 01/02/2013 | |
E-glass fibres of representative composition [Calcium-aluminium-silicate fibres with random orientation with the following representative composition (% given by weight): SiO2 50.0-56.0%, Al2O3 13.0-16.0%, B2O3 5.8-10.0%, Na2O <0.6%, K2O <0.4%, CaO 15.0-24.0%, MgO <5.5%, Fe2O3 <0.5%, F2 <1.0% with note R. Process: typically produced by flame attenuation and rotary process. (Additional individual elements may be present at low levels,the process list does not preclude innovation).] | - | - | 22/04/2014 | |
emamectin benzoate (ISO); (4’’R)-4’’-deoxy-4’’-(methylamino)avermectin B1 benzoate | - | 155569-91-8 | 11/01/2019 | |
Epoxiconazole | 406-850-2 | 133855-98-8 | 09/04/2009 | |
esfenvalerate (ISO); (S)-α-cyano-3-phenoxybenzyl-(S)-2-(4-chlorophenyl)-3-methylbutyrate | - | 66230-04-4 | 01/03/2019 | |
ethametsulfuron-methyl (ISO); methyl 2-({[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)benzoate | - | 97780-06-8 | 01/03/2019 | |
Ethanol, 2,2'-iminobis-, N-(C13-15-branched and linear alkyl) derivs. | 308-208-6 | 97925-95-6 | 16/01/2017 | |
Ethanol, 2,2'-iminobis-, N-(C13-15-branched and linear alkyl) derivs. | 308-208-6 | 97925-95-6 | 25/04/2017 | |
Ethephon | 240-718-3 | 16672-87-0 | 29/07/2011 | |
ethofumesate (ISO) (±)-2-ethoxy-2,3-dihydro-3,3-dimethylbenzofuran-5-yl methanesulfonate | 247-525-3 | 26225-79-6 | 19/05/2017 | |
ethyl acrylate | 205-438-8 | 140-88-5 | 24/04/2020 | |
Ethylbenzene | 202-849-4 | 100-41-4 | 03/03/2011 | |
ethylene oxide | 200-849-9 | 75-21-8 | 18/11/2016 | |
Etofenprox | 407-980-2 | 80844-07-1 | 12/03/2012 | |
Etridiazole | 219-991-8 | 2593-15-9 | 13/04/2012 | |
Exo-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl acrylate; isobornyl acrylate | 227-561-6 | 5888-33-5 | 24/09/2019 | |
Fenamiphos | 244-848-1 | 22224-92-6 | 03/12/2010 | |
Fenoxaprop-P-ethyl | - | 71283-80-2 | 01/06/2012 | |
Fenoxycarb | 276-696-7 | 72490-01-8 | 01/10/2011 | |
Fenpyrazamine | - | 473798-59-3 | 12/03/2012 | |
Fenpyrazamine (ISO),S-allyl 5-amino-2,3-dihydro-2-isopropyl-3-oxo-4-(o-tolyl)pyrazole-1-carbothioate | - | 473798-59-3 | 22/08/2014 | |
Fenpyroximate (ISO),tert-butyl 4-[({[(E)-(1,3-dimethyl-5-phenoxy-1H-pyrazol-4-yl)methylene]amino}oxy)methyl]benzoate | - | 134098-61-6 | 14/06/2013 | |
Fipronil (ISO),5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(trifluoromethyl)sulfinyl]-1H-pyrazole-3-carbonitrile | 424-610-5 | 120068-37-3 | 10/11/2014 | |
Flocoumafen (ISO),reaction mass of: cis-4-hydroxy-3-(1,2,3,4- tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin,trans-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4- (4-trifluoromethylbenzyloxy)phenyl)-1- naphthyl)coumarin | 421-960-0 | 90035-08-8 | 19/04/2013 | |
Flonicamid | - | 158062-67-0 | 06/08/2012 | |
Fluazinam | - | 79622-59-6 | 04/07/2011 | |
fludioxonil (ISO); 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1H-pyrrole-3-carbonitrile | - | 131341-86-1 | 02/09/2016 | |
Flufenoxuron | 417-680-3 | 101463-69-8 | 14/05/2010 | |
Flumioxazin (ISO),N-(7-fluoro-3,4-dihydro-3-oxo-4-prop-2-ynyl-2H-1,4-benzoxazin-6-yl)cyclohex-1-ene-1,2-dicarboxamide | - | 103361-09-7 | 21/10/2013 | |
flumioxazin (ISO); N-(7-fluoro-3,4-dihydro-3-oxo-4-prop-2-ynyl-2H-1,4-benzoxazin-6-yl)cyclohex-1-ene-1,2-dicarboximide | - | 103361-09-7 | 08/06/2018 | |
fluopicolide (ISO); 2,6-dichloro-N-[3-chloro-5-(trifluoromethyl)-2-pyridylmethyl]benzamide | 607-285-6 | 239110-15-7 | 11/10/2019 | |
Fluopyram (ISO),N-{2-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]ethyl}-2-(trifluoromethyl)benzamide | - | 658066-35-4 | 25/11/2013 | |
flutianil (ISO); (2Z)-{[2-fluoro-5-(trifluoromethyl)phenyl]thio}[3-(2-methoxyphenyl)-1,3-thiazolidin-2-ylidene]acetonitrile | - | 958647-10-4 | 31/07/2015 | |
foramsulfuron (ISO); 2-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-4-formamido-N,N-dimethylbenzamide; 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-dimethylcarbamoyl-5-formamidophenylsulfonyl)urea | - | 173159-57-4 | 22/05/2020 | |
Formaldehyde | 200-001-8 | 50-00-0 | 15/12/2011 | |
Fuberidazole | 223-404-0 | 3878-19-1 | 03/03/2010 | |
Gallium arsenide | 215-114-8 | 1303-00-0 | 27/07/2009 | |
Gallium arsenide | 215-114-8 | 1303-00-0 | 27/04/2011 | |
geraniol; (2E)-3,7-dimethylocta-2,6-dien-1-ol | 203-377-1 | 106-24-1 | 01/12/2017 | |
Glass fibres of representative composition [Calcium-aluminium-silicate fibres with random orientation with the following composition (% given by weight): SiO2 55.0-60.0%, Al2O3 4.0-7.0%, B2O3 8.0-11.0%, ZrO2 0.0-4.0%, Na2O 9.5-13.5%, K2O 0.0-4.0%, CaO 1.0-5.0%, MgO 0.0-2.0%, Fe2O3 <0.2%, ZnO 2.0-5.0%, BaO 3.0-6.0%, F2 <1.0% with note R. Process: typically produced by flame attenuation and rotary process. (Additional individual elements may be present at low levels,the process list does not preclude innovation).] | - | - | 22/04/2014 | |
Glutaral,Glutaraldehyde,1,5-pentanedial | 203-856-5 | 111-30-8 | 11/11/2013 | |
glyoxylic acid …% | 206-058-5 | 298-12-4 | 04/09/2017 | |
glyphosate (ISO); N-(phosphonomethyl)glycine | 213-997-4 | 1071-83-6 | 18/07/2016 | |
Granulated copper | 231-159-6 | 7440-50-8 | 19/05/2017 | |
halosulfuron-methyl (ISO); methyl 3-chloro-5-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-1-methyl-1H-pyrazole-4-carboxylate | - | 100784-20-1 | 23/09/2016 | |
Hexabromocyclododecane (HBCDD) |
247-148-4 221-695-9 | 25637-99-4 3194-55-6 | 12/07/2010 | |
Hexaflumuron (ISO),1-(3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl)-3-(2,6-difluorobenzoyl)urea | 401-400-1 | 86479-06-3 | 17/07/2015 | |
Hexyl 2-(1-(diethylaminohydroxyphenyl)methanoyl)benzoate; hexyl 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate | 443-860-6 | 302776-68-7 | 12/01/2018 | |
hexythiazox (ISO); trans-5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-3-thiazolidine-carboxamide | - | 78587-05-0 | 02/02/2018 | |
hydrogen sulphide, hydrogen sulfide | 231-977-3 | 7783-06-4 | 18/12/2020 | |
Hydroxyisohexyl 3-cyclohexene carboxaldehyde (INCI),reaction mass of 4-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde and 3-(4- hydroxy-4-methylpentyl)cyclohex-3-ene-1- carbaldehyde [1],4-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde [2],3-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde [3] |
250-863-4 257-187-9 | 31906-04-4 51414-25-6 | 16/08/2013 | |
hymexazol (ISO); 3-hydroxy-5-methylisoxazole | 233-000-6 | 10004-44-1 | 01/12/2017 | |
Imazalil | 252-615-0 | 35554-44-0 | 05/10/2012 | |
imazamox (ISO); (RS)-2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-5-methoxymethylnicotinic acid | - | 114311-32-9 | 24/05/2019 | |
imidacloprid (ISO); (E)-1-(6-chloro-3-pyridylmethyl)-N-nitroimidazolidin-2-ylideneamine | - | 138261-41-3 | 07/12/2018 | |
Imidazole | 206-019-2 | 288-32-4 | 01/02/2013 | |
imiprothrin (ISO); reaction mass of: [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-cis-chrysanthemate; [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-trans-chrysanthemate | 428-790-6 | 72963-72-5 | 28/04/2017 | |
Indium Phosphide | 244-959-5 | 22398-80-7 | 27/07/2009 | |
Indoxacarb and Indoxacarb (enantiomeric reaction mass S:R 75:25) | - | 173584-44-6 | 10/11/2010 | |
ipconazole (ISO); (1RS,2SR,5RS;1RS,2SR,5SR)-2-(4-chlorobenzyl)-5-isopropyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol (CAS No 125225-28-7, all stereoisomers; 115850-69-6, cis-cis racemate; 115937-89-8, cist-trans racemate) | - |
125225-28-7 115850-69-6 115937-89-8 | 28/04/2017 | |
Iprovalicarb (ISO); isopropyl [(2S)-3-methyl-1-{[1-(4-methylphenyl)ethyl]amino}-1-oxobutan-2-yl]carbamate | - | 140923-17-7 | 19/03/2018 | |
isobutyl methacrylate | 202-613-0 | 97-86-9 | 11/12/2015 | |
isoeugenol;(E)-2-methoxy-4-(prop-1-enyl)phenol;(Z)-2-methoxy-4-(prop-1-enyl)phenol; |
202-590-7 227-678-2 227-633-7 | 97-54-1 5932-68-3 5912-86-7 | 14/08/2015 | |
isopropyl (2E,4E,7S)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate; S-methoprene | - | 65733-16-6 | 11/09/2015 | |
isoproturon (ISO); 3-(4-isopropylphenyl)-1,1-dimethylurea | 251-835-4 | 34123-59-6 | 25/01/2016 | |
Isoxaflutole | - | 141112-29-0 | 28/06/2012 | |
L-(+)-lactic acid; (2S)-2-hydroxypropanoic acid | 201-196-2 | 79-33-4 | 28/04/2017 | |
Lead | 231-100-4 | 7439-92-1 | 07/12/2012 | |
lead | 231-100-4 | 7439-92-1 | 30/10/2017 | |
Lenacil (ISO),3-cyclohexyl-6,7-dihydro-1H-cyclopenta[d]pyrimidine-2,4(3H,5H)-dione | 218-499-0 | 2164-08-1 | 28/06/2013 | |
Leucomalachite Green | 204-961-9 | 129-73-7 | 05/08/2010 | |
Linalool,(S,R)-3,7-dimethyl-1,6-octadien-3-ol,dl-linalool; Coriandrol,(S)-3,7-dimethyl-1,6-octadien-3-ol,d-linalool; Licareol,(R)-3,7-dimethyl-1,6-octadien-3-ol,l-linaloo |
201-134-4 204-810-7 204-811-2 | 78-70-6 126-90-9 126-91-0 | 08/08/2014 | |
lithium carbonate [1] lithium chloride [2] lithium hydroxide [3] |
209-062-5 231-212-3 215-183-4 | 554-13-2 7447-41-8 1310-65-2 | 02/10/2020 | |
Lithium sodium 3-amino-10-{4-(10- amino-6, 13-dichloro-4,11- disulfonatobenzo[5,6][1,4]oxazino[2,3 -b]phenoxazine-3-ylamino)-6- [methyl(2-sulfonato-ethyl)amino]- 1,3,5-triazin-2-ylamino}-6,13- dichlorobenzo[5,6][1,4]oxazino[2,3- b]phenoxazine-4,11-disulfonate; Direct Blue FC 57087 | 418-870-9 | 154212-58-5 | 10/05/2013 | |
m-bis(2,3-epoxypropoxy)benzene | 202-987-5 | 101-90-6 | 11/05/2018 | |
Maleic anhydride | 203-571-6 | 108-31-6 | 25/01/2016 | |
mancozeb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) complex with zinc salt | 616-995-5 | 8018-01-7 | 27/04/2018 | |
Mandipropamid | - | 374726-62-2 | 13/04/2012 | |
Margosa, ext. [cold-pressed oil of Azadirachta indica seeds without shells extracted with super-critical carbon dioxide] | 283-644-7 | 84696-25-3 | 28/04/2017 | |
Margosa, ext. [from the kernels of Azadirachta indicaextract ed with water and further processed with organic solvents] | 283-644-7 | 84696-25-3 | 24/01/2020 | |
Margosa, ext.,[margosa extract from the kernels of Azadirachta indica extracted with water and further processed with organic solvents] | 283-644-7 | 84696-25-3 | 05/12/2014 | |
MCPA-thioethyl (ISO); S-ethyl (4-chloro-2-methylphenoxy)ethanethioate; S-ethyl 4-chloro-o-tolyloxythioacetate | 246-831-4 | 25319-90-8 | 07/04/2017 | |
mecetronium etilsulfate; N-ethyl-N,N-dimethylhexadecan-1-aminium ethyl sulfate; Mecetronium ethyl sulphate [MES] | 221-106-5 | 3006-10-8 | 14/07/2017 | |
mecoprop-P (ISO) [1] and its salts; (R)-2-(4-chloro-2-methylphenoxy)propionic acid [1] and its salts | 240-539-0 | 16484-77-8 | 07/12/2018 | |
mepiquat chloride (ISO); 1,1-dimethylpiperidinium chloride | 246-147-6 | 24307-26-4 | 01/06/2020 | |
mesosulfuron-methyl; methyl 2-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-4-{[(methylsulfonyl)amino]methyl}benzoate | - | 208465-21-8 | 05/02/2016 | |
mesotrione (ISO); 2-[4-(methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione | - | 104206-82-8 | 01/12/2017 | |
metaflumizone (ISO); (EZ)-2'-[2-(4-cyanophenyl)-1-(α,α,α-trifluoro-m-tolyl)ethylidene]-[4-(trifluoromethoxy)phenyl]carbanilohydrazide [E-isomer > 90%, Z-isomer <10% relative content] [1] (E)-2'-[2-(4-cyanophenyl)-1-(α,α,α-trifluoro-m-tolyl)ethylidene]-[4-(trifluoromethoxy)phenyl]carbanilohydrazide [2] | - |
139968-49-3 852403-68-0 | 13/02/2017 | |
Metaldehyde | 203-600-2 | 108-62-3 | 07/12/2012 | |
metaldehyde (ISO); 2,4,6,8-tetramethyl-1,3,5,7-tetraoxacyclooctane | 203-600-2 | 108-62-3 | 23/09/2016 | |
Metazachlor | 266-583-0 | 67129-08-2 | 26/04/2010 | |
Methanol | 200-659-6 | 67-56-1 | 13/12/2013 | |
Methyl 2,5-dichlorobenzoate | 220-815-7 | 2905-69-3 | 01/10/2011 | |
methyl acrylate; methyl propenoate | 202-500-6 | 96-33-3 | 24/04/2020 | |
Methyl iodide,Iodomethane | 200-819-5 | 74-88-4 | 20/01/2014 | |
methyl methacrylate methyl 2-methylprop-2-enoate; methyl 2-methylpropenoate | 201-297-1 | 80-62-6 | 05/07/2019 | |
methyl N-(isopropoxycarbonyl)-L-valyl-(3RS)-3-(4-chlorophenyl)-β-alaninate; valifenalate | - | 283159-90-0 | 03/04/2020 | |
methyl salicylate | 204-317-7 | 119-36-8 | 25/01/2019 | |
methylhydrazine | 200-471-4 | 60-34-4 | 31/07/2015 | |
methylhydrazine | 200-471-4 | 60-34-4 | 02/01/2015 | |
Methylmercuric chloride | 204-064-2 | 115-09-3 | 13/06/2016 | |
Metosulam | - | 139528-85-1 | 28/06/2012 | |
metribuzin (ISO); 4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5(4H)-one; 4-amino-4,5-dihydro-6-(1,1-dimethylethyl)-3-methylthio-1,2,4-triazin-5-one | 244-209-7 | 21087-64-9 | 02/10/2020 | |
N,N-diethyl-m-toluamide; deet | 205-149-7 | 134-62-3 | 15/08/2016 | |
N,N-dimethyl-p-toluidine | 202-805-4 | 99-97-8 | 21/08/2020 | |
N,N-dimethylacetamide | 204-826-4 | 127-19-5 | 27/01/2014 | |
N-(2-nitrophenyl)phosphoric triamide | 477-690-9 | 874819-71-3 | 25/10/2019 | |
N-(5-chloro-2-isopropylbenzyl)-N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methyl-1H-pyrazole-4-carboxamide; isoflucypram | - | 1255734-28-1 | 26/07/2019 | |
N-(hydroxymethyl)acrylamide; methylolacrylamide; [NMA] | 213-103-2 | 924-42-5 | 04/08/2017 | |
N-carboxymethyl iminobis(ethylenenitrilo)tetra(acetic acid) | 200-652-8 | 67-43-6 | 15/07/2016 | |
N-ethyl-2-pyrrolidone (NEP) | 220-250-6 | 2687-91-4 | 09/05/2011 | |
N-methoxy-N-[1-methyl-2-(2,4,6-trichlorophenyl)-ethyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide; pydiflumetofen | - | 1228284-64-7 | 08/06/2018 | |
N-methyl-2-pyrrolidone,1-methyl-2-pyrrolidone | 212-828-1 | 872-50-4 | 11/10/2013 | |
N-{2-[[1,1'-bi(cyclopropyl)]-2-yl]phenyl}-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxamide; sedaxane | - | 874967-67-6 | 03/08/2018 | |
nickel (II) sulfide; [1] nickel sulfide; [2] millerite [3] |
234-349-7 240-841-2 | 11113-75-0 1314-04-1 16812-54-7 | 30/09/2016 | |
nickel bis(sulfamidate)|nickel sulfamate | 237-396-1 | 13770-89-3 | 16/01/2017 | |
nicotine (ISO); 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine | 200-193-3 | 54-11-5 | 05/06/2015 | |
Nitric acid | 231-714-2 | 7697-37-2 | 06/08/2012 | |
nitric acid ... % | 231-714-2 | 7697-37-2 | 09/06/2017 | |
Nitrobenzene | 202-716-0 | 98-95-3 | 03/03/2011 | |
nonadecafluorodecanoic acid; ammonium nonadecafluorodecanoate; sodium nonadecafluorodecanoate |
206-400-3 221-470-5 | 335-76-2 3108-42-7 3830-45-3 | 31/07/2015 | |
Nonanoic acid | 203-931-2 | 112-05-0 | 06/08/2012 | |
Nonylphenol, branched and linear, ethoxylated (with 352 g/mol ≤ average molecular weight < 704 g/mol) [includes ortho-, meta-, para- isomers or any combination thereof] |
230-770-5 248-743-1 247-555-7 248-293-6 and others | 127087-87-0 9016-45-9 7311-27-5 27942-27-4 26264-02-8 27177-05-5 14409-72-4 and others | 02/10/2020 | |
Nonylphenol, branched and linear, ethoxylated (with 704 g/mol ≤ average molecular weight ≤ 1540 g/mol) [includes ortho-, meta-, para- isomers or any combination thereof]) | - |
127087-87-0 9016-45-9 and others | 02/10/2020 | |
Nonylphenol, branched and linear, ethoxylated (with average molecular weight < 352 g/mol) [includes ortho-, meta-, para- isomers or any combination thereof]. |
500-315-8 500-024-6 500-045-0 500-209-1 248-762-5 243-816-4 248-291-5 and others | 127087-87-0 9016-45-9 26027-38-3 68412-54-4 27986-36-3 20427-84-3 27176-93-8 1119449-38-5 and others | 02/10/2020 | |
Octadecylamine | 204-695-3 | 124-30-1 | 03/12/2010 | |
Octamethylcyclotetrasiloxane | 209-136-7 | 556-67-2 | 07/04/2017 | |
Octanoic acid | 204-677-5 | 124-07-2 | 06/08/2012 | |
octhilinone (ISO); 2-octyl-2H-isothiazol-3-one; [OIT] | 247-761-7 | 26530-20-1 | 11/05/2018 | |
oxathiapiprolin (ISO); 1-(4-{4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl}piperidin-1-yl)-2-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]ethanone | - | 1003318-67-9 | 11/05/2018 | |
p-mentha-1,3-diene; 1-isopropyl-4-methylcyclohexa-1,3-diene; alpha-terpinene | 202-795-1 | 99-86-5 | 20/07/2018 | |
p-tert-butylphenol | 202-679-0 | 98-54-4 | 21/02/2011 | |
paclobutrazol (ISO); (2RS,3RS)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)-pentan-3-ol | - | 76738-62-0 | 07/07/2017 | |
Penconazole | 266-275-6 | 66246-88-6 | 03/03/2011 | |
Pencycuron (ISO),1-[(4-chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea | 266-096-3 | 66063-05-6 | 13/06/2014 | |
pendimethalin (ISO); N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidine | 254-938-2 | 40487-42-1 | 14/06/2019 | |
pentapotassium 2,2',2'',2''',2''''-(ethane-1,2-diylnitrilo)pentaacetate | 404-290-3 | 7216-95-7 | 15/07/2016 | |
pentasodium (carboxylatomethyl)iminobis(ethylenenitrilo)tetraacetate | 205-391-3 | 140-01-2 | 04/04/2016 | |
Penthiopyrad (ISO),(RS)-N-[2-(1,3-dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide | - | 183675-82-3 | 17/07/2015 | |
Perestane | 432-790-1 | 847871-03-8 | 09/05/2011 | |
perfluoroheptanoic acid; tridecafluoroheptanoic acid | 206-798-9 | 375-85-9 | 24/01/2020 | |
Perfluorononan-1-oic acid and its salts | 206-801-3 |
375-95-1 21049-39-8 4149-60-4 | 27/01/2014 | |
Perfluorooctanic acid (PFOA) and its salts | 206-397-9 | 335-67-1 | 21/02/2011 | |
phenmedipham (ISO);methyl 3-(3-methylcarbaniloyloxy)carbanilate | 237-199-0 | 13684-63-4 | 15/02/2019 | |
Phenol, dodecyl-, branched [Tetrapropenylphenol (TPP)] | 310-154-3 | 121158-58-5 | 19/04/2013 | |
Phenol, dodecyl-, branched,Phenol, (tetrapropenyl) derivatives | 310-154-3 |
121158-58-5 74499-35-7 | 01/02/2013 | |
Phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide | 423-340-5 | 162881-26-7 | 30/09/2016 | |
Phosmet (ISO),S-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl] O,O-dimethyl phosphorodithioate | 211-987-4 | 732-11-6 | 16/11/2015 | |
phosphine | 232-260-8 | 7803-51-2 | 13/04/2018 | |
picolinafen (ISO); N-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxamide; 4′-fluoro-6-[(α,α,α-trifluoro-m-tolyl)oxy]picolinanilide | - | 137641-05-5 | 04/12/2020 | |
pinoxaden (ISO); 8-(2,6-diethyl-4-methylphenyl)-7-oxo-1,2,4,5-tetrahydro-7H-pyrazolo[1,2-d][1,4,5]oxadiazepin-9-yl 2,2-dimethylpropanoate | - | 243973-20-8 | 16/11/2015 | |
piperonyl butoxide (ISO); 2-(2-butoxyethoxy)ethyl 6-propylpiperonyl ether | 200-076-7 |
51-03-6 12750-92-4 | 30/08/2019 | |
Pirimicarb (ISO),5,6-dimethyl-2-dimethylamino-pyrimidin-4-yl N,N-dimethylcarbamate | 245-430-1 | 23103-98-2 | 21/07/2014 | |
pirimiphos-methyl (ISO); O-[2-(diethylamino)-6-methylpyrimidin-4-yl] O,O-dimethyl phosphorothioate | 249-528-5 | 29232-93-7 | 13/04/2018 | |
Pitch, coal tar, high temp. | 266-028-2 | 65996-93-2 | 15/11/2010 | |
Polyhexamethylene biguanide or Poly(hexamethylene) biguanide or PHMB | - |
27083-27-8 32289-58-0 | 14/05/2010 | |
Polyhexamethylene,biguanide hydrochloride (PHMB) | - |
27083-27-8 32289-58-0 | 22/07/2013 | |
potassium (oxido-NNO-azoxy)cyclohexane; cyclohexylhydroxydiazene 1-oxide, potassium salt; [K-HDO] | - | 66603-10-9 | 12/01/2018 | |
Potassium chlorate | 223-289-7 | 3811-04-9 | 03/07/2020 | |
Potassium permanganate | 231-760-3 | 7722-64-7 | 04/04/2016 | |
Potassium sorbate | 246-376-1 | 24634-61-5 | 28/06/2012 | |
propane-1,2-diol | 200-338-0 | 57-55-6 | 21/04/2016 | |
propiconazole (ISO); (2RS,4RS;2RS,4SR)-1-{[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl}-1H-1,2,4-triazole | 262-104-4 | 60207-90-1 | 16/05/2016 | |
Propylene oxide,1,2-epoxypropane,Methyloxirane | 200-879-2 | 75-56-9 | 21/10/2013 | |
Proquinazid | - | 189278-12-4 | 22/07/2011 | |
prothioconazole (ISO); 2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione | - | 178928-70-6 | 22/06/2018 | |
pymetrozine (ISO); (E)-4,5-dihydro-6-methyl-4-(3-pyridylmethyleneamino)-1,2,4-triazin-3(2H)-one | - | 123312-89-0 | 04/09/2017 | |
Pyridaben (2-tert-butyl-5-(4-tert-butylbenzylthio)-4-chloropyridazin-3(2H)-one ) | 405-700-3 | 96489-71-3 | 01/02/2013 | |
pyridalyl (ISO); 2,6-dichloro-4-(3,3-dichloroallyloxy)phenyl 3-[5-(trifluoromethyl)-2-pyridyloxy]propyl ether | - | 179101-81-6 | 24/05/2019 | |
pyridate (ISO); O-(6-chloro-3-phenylpyridazin- 4-yl) S-octyl thiocarbonate | 259-686-7 | 55512-33-9 | 24/02/2017 | |
pyridine-2-thiol 1-oxide, sodium salt; pyrithione sodium; sodium pyrithione |
223-296-5 240-062-8 | 3811-73-2 15922-78-8 | 05/07/2019 | |
pyrithione zinc; (T-4)-bis[1-(hydroxy-.kappa.O)pyridine-2(1H)-thionato-.kappa.S]zinc | 236-671-3 | 13463-41-7 | 07/07/2017 | |
Pyroxsulam | - | 422556-08-9 | 31/07/2015 | |
quinoclamine (ISO); 2-amino-3-chloro-1,4-naphthoquinone | 220-529-2 | 2797-51-5 | 16/08/2019 | |
Categories Display
Route: .live2