- ECHA
- Consultations
- Harmonised classification and labelling consultations
- Harmonised classification and labelling previous consultations
Harmonised classification and labelling previous consultations
Several consultations on the proposed harmonised classifications and labelling for a number of substances have already taken place and have now been closed. These substances are listed in the table below together with the CLH proposals. The comments received during the consultation, along with the non-confidential attachments, are available on the Registry of CLH intentions until outcome.
After finalising the consultation, the proposals, together with the comments received, will be discussed by ECHA's Risk Assessment Committee, which will issue a scientific opinion on the proposal.
All documentation will be submitted to the European Commission which in the end will decide on the classification. Any new classifications will be included in the list of harmonised classifications (Annex VI to the CLP Regulation) and will also be published on ECHA's website.
Benzyl alcohol | 202-859-9 | 100-51-6 | 18/12/2020 | |
hydrogen sulphide, hydrogen sulfide | 231-977-3 | 7783-06-4 | 18/12/2020 | |
Silver | 231-131-3 | 7440-22-4 | 18/12/2020 | |
9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethylxanthylium chloride; Basic Red 1 | 213-584-9 | 989-38-8 | 04/12/2020 | |
picolinafen (ISO); N-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxamide; 4′-fluoro-6-[(α,α,α-trifluoro-m-tolyl)oxy]picolinanilide | - | 137641-05-5 | 04/12/2020 | |
Sulphur dioxide | 231-195-2 | 7446-09-5 | 13/11/2020 | |
1-phenylethan-1-one (1-phenylethylidene)hydrazone | 211-979-0 | 729-43-1 | 23/10/2020 | |
clothianidin (ISO); (E)-1-(2-chloro-1,3-thiazol-5-ylmethyl)-3-methyl-2-nitroguanidine | 433-460-1 | 210880-92-5 | 23/10/2020 | |
cymoxanil (ISO); 2-cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamide | 261-043-0 | 57966-95-7 | 23/10/2020 | |
Dimethyl propylphosphonate | 242-555-3 | 18755-43-6 | 23/10/2020 | |
Diphenyl(2,4,6-trimethylbenzoyl)phosphine oxide | 278-355-8 | 75980-60-8 | 23/10/2020 | |
lithium carbonate [1] lithium chloride [2] lithium hydroxide [3] |
209-062-5 231-212-3 215-183-4 | 554-13-2 7447-41-8 1310-65-2 | 02/10/2020 | |
metribuzin (ISO); 4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5(4H)-one; 4-amino-4,5-dihydro-6-(1,1-dimethylethyl)-3-methylthio-1,2,4-triazin-5-one | 244-209-7 | 21087-64-9 | 02/10/2020 | |
Nonylphenol, branched and linear, ethoxylated (with 352 g/mol ≤ average molecular weight < 704 g/mol) [includes ortho-, meta-, para- isomers or any combination thereof] |
230-770-5 248-743-1 247-555-7 248-293-6 and others | 127087-87-0 9016-45-9 7311-27-5 27942-27-4 26264-02-8 27177-05-5 14409-72-4 and others | 02/10/2020 | |
Nonylphenol, branched and linear, ethoxylated (with 704 g/mol ≤ average molecular weight ≤ 1540 g/mol) [includes ortho-, meta-, para- isomers or any combination thereof]) | - |
127087-87-0 9016-45-9 and others | 02/10/2020 | |
Nonylphenol, branched and linear, ethoxylated (with average molecular weight < 352 g/mol) [includes ortho-, meta-, para- isomers or any combination thereof]. |
500-315-8 500-024-6 500-045-0 500-209-1 248-762-5 243-816-4 248-291-5 and others | 127087-87-0 9016-45-9 26027-38-3 68412-54-4 27986-36-3 20427-84-3 27176-93-8 1119449-38-5 and others | 02/10/2020 | |
4-Nitrosomorpholine | 627-564-6 | 59-89-2 | 21/08/2020 | |
N,N-dimethyl-p-toluidine | 202-805-4 | 99-97-8 | 21/08/2020 | |
diuron (ISO); 3-(3,4-dichlorophenyl)-1,1-dimethylurea | 206-354-4 | 330-54-1 | 31/07/2020 | |
Potassium chlorate | 223-289-7 | 3811-04-9 | 03/07/2020 | |
Reaction mass of 1-(2,3-epoxypropoxy)-2,2-bis ((2,3-epoxypropoxy)methyl) butane and 1-(2,3-epoxypropoxy)-2-((2,3-epoxypropoxy)methyl)-2-hydroxymethyl butane | - | - | 03/07/2020 | |
Sodium chlorate | 231-887-4 | 7775-09-9 | 03/07/2020 | |
difenoconazole (ISO); 1-({2-[2-chloro-4-(4-chlorophenoxy)phenyl]-4-methyl-1,3-dioxolan-2-yl}methyl)-1H-1,2,4-triazole; 3-chloro-4-[(2RS,4RS;2RS,4SR)-4-methyl-2-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]phenyl 4-chlorophenyl ether | 601-613-1 | 119446-68-3 | 01/06/2020 | |
mepiquat chloride (ISO); 1,1-dimethylpiperidinium chloride | 246-147-6 | 24307-26-4 | 01/06/2020 | |
cinnamaldehyde; 3-phenylprop-2-enal; cinnamic aldehyde; cinnamal [1] (2E)-3-phenylprop-2-enal [2] | 203-213-9 [1] 604-377-8 [2] | 104-55-2 [1] 14371-10-9 [2] | 22/05/2020 | |
foramsulfuron (ISO); 2-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-4-formamido-N,N-dimethylbenzamide; 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-dimethylcarbamoyl-5-formamidophenylsulfonyl)urea | - | 173159-57-4 | 22/05/2020 | |
3,3'-dimethylbiphenyl-4,4'-diyl diisocyanate; [TODI] | 202-112-7 | 91-97-4 | 08/05/2020 | |
4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol; bisphenol AF | 216-036-7 | 1478-61-1 | 08/05/2020 | |
benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate | 479-100-5 | 577705-90-9 | 08/05/2020 | |
Benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[phenol] (1:1) | 278-305-5 | 75768-65-9 | 08/05/2020 | |
Reaction mass of 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol and benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate (1:1) | - | - | 08/05/2020 | |
Reaction mass of 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol and benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[phenol] (1:1) | - | - | 08/05/2020 | |
6-[(C10-C13)-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid | 701-118-1 | 2156592-54-8 | 24/04/2020 | |
6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid | 701-162-1 | - | 24/04/2020 | |
6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid, sodium and tris(2-hydroxyethyl)ammonium salts | 701-271-4 | - | 24/04/2020 | |
allyl methacrylate; 2-methyl-2-propenoic acid 2-propenyl ester | 202-473-0 | 96-05-9 | 24/04/2020 | |
ethyl acrylate | 205-438-8 | 140-88-5 | 24/04/2020 | |
methyl acrylate; methyl propenoate | 202-500-6 | 96-33-3 | 24/04/2020 | |
di-n-butylamine | 203-921-8 | 111-92-2 | 03/04/2020 | |
methyl N-(isopropoxycarbonyl)-L-valyl-(3RS)-3-(4-chlorophenyl)-β-alaninate; valifenalate | - | 283159-90-0 | 03/04/2020 | |
triethylamine | 204-469-4 | 121-44-8 | 03/04/2020 | |
1,3,5-triazine-2,4,6-triamine; melamine | 203-615-4 | 108-78-1 | 07/02/2020 | |
4,4'-sulphonyldiphenol; bisphenol S | 201-250-5 | 80-09-1 | 07/02/2020 | |
benfluralin (ISO); N-butyl-N-ethyl-α,α,α-trifluoro-2,6-dinitro-p-toluidine | 217-465-2 | 1861-40-1 | 07/02/2020 | |
transfluthrin (ISO); 2,3,5,6-tetrafluorobenzyl (1R,3S)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | 405-060-5 | 118712-89-3 | 07/02/2020 | |
Margosa, ext. [from the kernels of Azadirachta indicaextract ed with water and further processed with organic solvents] | 283-644-7 | 84696-25-3 | 24/01/2020 | |
perfluoroheptanoic acid; tridecafluoroheptanoic acid | 206-798-9 | 375-85-9 | 24/01/2020 | |
bentazone (ISO); 3-isopropyl-2,1,3-benzothiadiazine-4-one-2,2-dioxide | 246-585-8 | 25057-89-0 | 10/01/2020 | |
2-[N-ethyl-4-[(5-nitrothiazol-2-yl)azo]-m-toluidino]ethyl acetate; C.I. Disperse Blue 124 | 239-203-6 | 15141-18-1 | 13/12/2019 | |
barium diboron tetraoxide | 237-222-4 | 13701-59-2 | 13/12/2019 | |
theophylline; 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione | 200-385-7 | 58-55-9 | 13/12/2019 | |
Cumene | 202-704-5 | 98-82-8 | 22/11/2019 | |
Dibutyltin bis(2-ethylhexanoate) | 220-481-2 | 2781-10-4 | 22/11/2019 | |
Dibutyltin di(acetate) | 213-928-8 | 1067-33-0 | 22/11/2019 | |
divanadium pentaoxide; vanadium pentoxide | 215-239-8 | 1314-62-1 | 22/11/2019 | |
Reaction mass of 3-(difluoromethyl)-1-methyl-N-[(1RS,4SR,9RS)-1,2,3,4-tetrahydro-9-isopropyl-1,4-methanonaphthalen-5-yl]pyrazole-4-carboxamide and 3-(difluoromethyl)-1-methyl-N-[(1RS,4SR,9SR)-1,2,3,4-tetrahydro-9-isopropyl-1,4-methanonaphthalen-5-yl]pyrazole-4-carboxamide; isopyrazam | - | 881685-58-1 | 22/11/2019 | |
1,3-bis(1-isocyanato-1-methylethyl)benzene | 220-474-4 | 2778-42-9 | 25/10/2019 | |
1,3-bis(isocyanatomethyl)benzene | 222-852-4 |
3634-83-1 53208-23-4 125671-35-4 | 25/10/2019 | |
1,5-naphthylene diisocyanate | 221-641-4 | 3173-72-6 | 25/10/2019 | |
2,4,6-triisopropyl-m-phenylene diisocyanate | 218-485-4 | 2162-73-4 | 25/10/2019 | |
N-(2-nitrophenyl)phosphoric triamide | 477-690-9 | 874819-71-3 | 25/10/2019 | |
2-ethyl-2-[[(1-oxoallyl)oxy]methyl]-1,3-propanediyl diacrylate; 2,2-bis(acryloyloxymethyl)butyl acrylate;trimethylolpropane triacrylate | 239-701-3 | 15625-89-5 | 11/10/2019 | |
4,4'-oxydi(benzenesulphonohydrazide) | 201-286-1 | 80-51-3 | 11/10/2019 | |
Benzophenone | 204-337-6 | 119-61-9 | 11/10/2019 | |
fluopicolide (ISO); 2,6-dichloro-N-[3-chloro-5-(trifluoromethyl)-2-pyridylmethyl]benzamide | 607-285-6 | 239110-15-7 | 11/10/2019 | |
Toluene-4-sulphonohydrazide | 216-407-3 | 1576-35-8 | 11/10/2019 | |
2,2-dimethylpropan-1-ol, tribromo derivative; 3-bromo-2,2-bis(bromomethyl)propan-1-ol | 253-057-0 |
36483-57-5 1522-92-5 | 24/09/2019 | |
clofentezine (ISO); 3,6-bis(o-chlorophenyl)-1,2,4,5-tetrazine | 277-728-2 | 74115-24-5 | 24/09/2019 | |
daminozide (ISO); 4-(2,2-dimethylhydrazino)-4-oxobutanoic acid; N-dimethylaminosuccinamic acid | 216-485-9 | 1596-84-5 | 24/09/2019 | |
Exo-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl acrylate; isobornyl acrylate | 227-561-6 | 5888-33-5 | 24/09/2019 | |
4,4’-isopropylidenediphenol; bisphenol A | 201-245-8 | 80-05-7 | 30/08/2019 | |
dimoxystrobin (ISO); (2E)-2-{2-[(2,5-dimethylphenoxy)methyl]phenyl}-2-(methoxyimino)-N-methylacetamide; (E)-2-(methoxyimino)-N-methyl-2-[a-(2,5-xylyloxy)-o-tolyl]acetamide | - | 149961-52-4 | 30/08/2019 | |
piperonyl butoxide (ISO); 2-(2-butoxyethoxy)ethyl 6-propylpiperonyl ether | 200-076-7 |
51-03-6 12750-92-4 | 30/08/2019 | |
trichlorosilane | 233-042-5 | 10025-78-2 | 30/08/2019 | |
quinoclamine (ISO); 2-amino-3-chloro-1,4-naphthoquinone | 220-529-2 | 2797-51-5 | 16/08/2019 | |
Tellurium | 236-813-4 | 13494-80-9 | 16/08/2019 | |
Tellurium Dioxide | 231-193-1 | 7446-07-3 | 16/08/2019 | |
2-Ethylhexanoic acid and its salts, with the exception of those specified elsewhere in this Annex | - | - | 26/07/2019 | |
N-(5-chloro-2-isopropylbenzyl)-N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methyl-1H-pyrazole-4-carboxamide; isoflucypram | - | 1255734-28-1 | 26/07/2019 | |
2-(2-methoxyethoxy)ethanol; diethylene glycol monomethyl ether | 203-906-6 | 111-77-3 | 05/07/2019 | |
methyl methacrylate methyl 2-methylprop-2-enoate; methyl 2-methylpropenoate | 201-297-1 | 80-62-6 | 05/07/2019 | |
pyridine-2-thiol 1-oxide, sodium salt; pyrithione sodium; sodium pyrithione |
223-296-5 240-062-8 | 3811-73-2 15922-78-8 | 05/07/2019 | |
Ammonium bromide | 235-183-8 | 12124-97-9 | 14/06/2019 | |
pendimethalin (ISO); N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidine | 254-938-2 | 40487-42-1 | 14/06/2019 | |
1,4-dimethylnaphthalene | 209-335-9 | 571-58-4 | 31/05/2019 | |
2,4,6-tri-tert-butylphenol; [1] Reaction mass of 2,6-di-tert-butylphenol and 2,4,6-tri-tert-butylphenol; [2] Reaction mass of 2-tert-butylphenol and 2,6-di-tert-butylphenol and 2,4,6-tri-tert-butylphenol [3] | 211-989-5 | 732-26-3 | 31/05/2019 | |
beta-cyfluthrin (ISO); reaction mass of rel-(R)-cyano(4-fluoro-3-phenoxyphenyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate and rel-(R)-cyano(4-fluoro-3-phenoxyphenyl)methyl (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate | - | 1820573-27-0 | 24/05/2019 | |
cyfluthrin (ISO); α-cyano-4-fluoro-3-phenoxybenzyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | 269-855-7 | 68359-37-5 | 24/05/2019 | |
imazamox (ISO); (RS)-2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-5-methoxymethylnicotinic acid | - | 114311-32-9 | 24/05/2019 | |
pyridalyl (ISO); 2,6-dichloro-4-(3,3-dichloroallyloxy)phenyl 3-[5-(trifluoromethyl)-2-pyridyloxy]propyl ether | - | 179101-81-6 | 24/05/2019 | |
3-methylpyrazole | 215-925-7 | 1453-58-3 | 03/05/2019 | |
silanamine, 1,1,1-trimethyl-N-(trimethylsilyl)-, hydrolysis products with silica; pyrogenic, synthetic amorphous, nano, surface treated silicon dioxide | 272-697-1 | 68909-20-6 | 03/05/2019 | |
(3aS,5S,6R,7aR,7bS,9aS,10R,12aS,12bS)-10-[(2S,3R,4R,5R)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-5,6-dihydroxy-7a,9a-dimethylhexadecahydro-3H-benzo[c]indeno[5,4-e]oxepin-3-one; 24-epibrassinolide | - | 78821-43-9 | 22/03/2019 | |
acetamiprid (ISO); (1E)-N-[(6-chloropyridin-3-yl)methyl]-N'-cyano-N-methylethanimidamide; (E)-N1-[(6-chloro-3-pyridyl)methyl]-N2-cyano-N1-methylacetamidine | - |
135410-20-7 160430-64-8 | 22/03/2019 | |
carbendazim (ISO); methyl benzimidazol-2-ylcarbamate | 234-232-0 | 10605-21-7 | 22/03/2019 | |
cypermethrin (ISO); α-cyano-3-phenoxybenzyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate; cypermethrin cis/trans +/- 40/60 | 257-842-9 | 52315-07-8 | 22/03/2019 | |
Tetrafluoroethylene | 204-126-9 | 116-14-3 | 22/03/2019 | |
thiamethoxam (ISO); 3-(2-chloro-thiazol-5- ylmethyl)-5- methyl[1,3,5]oxadiazi nan-4-ylidene-N- nitroamine | 428-650-4 | 153719-23-4 | 22/03/2019 | |
dimethomorph (ISO); (E,Z)-4-(3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)acryloyl)morpholine | 404-200-2 | 110488-70-5 | 08/03/2019 | |
esfenvalerate (ISO); (S)-α-cyano-3-phenoxybenzyl-(S)-2-(4-chlorophenyl)-3-methylbutyrate | - | 66230-04-4 | 01/03/2019 | |
ethametsulfuron-methyl (ISO); methyl 2-({[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)benzoate | - | 97780-06-8 | 01/03/2019 | |
trifloxystrobin (ISO); methyl (E)-methoxyimino-{(E)-α-[1-(α,α,α-trifluoro-m-tolyl)ethylideneaminooxy]-o-tolyl}acetate | - | 141517-21-7 | 01/03/2019 | |
Boric acid [1]; Diboron trioxide [2]; Tetraboron disodium heptaoxide, hydrate [3]; Disodium tetraborate, anhydrous [4]; Orthoboric acid sodium salt [5]; Disodium tetraborate decahydrate [6]; Disodium tetraborate pentahydrate [7] |
233-139-2 234-343-4 215-125-8 235-541-3 215-540-4 237-560-2 | 10043-35-3 11113-50-1 1303-86-2 12267-73-1 1330-43-4 13840-56-7 1303-96-4 12179-04-3 | 22/02/2019 | |
desmedipham (ISO); ethyl 3-phenylcarbamoyloxyphenylcarbamate | 237-198-5 | 13684-56-5 | 15/02/2019 | |
phenmedipham (ISO);methyl 3-(3-methylcarbaniloyloxy)carbanilate | 237-199-0 | 13684-63-4 | 15/02/2019 | |
triticonazole (ISO); (RS)-(E)-5-(4-chlorobenzylidene)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-methyl)cyclopentanol | - | 138182-18-0 | 15/02/2019 | |
Citric acid | 201-069-1 | 77-92-9 | 08/02/2019 | |
clomazone (ISO); 2-(2-chlorobenzyl)-4,4-dimethyl-1,2-oxazolidin-3-one | - | 81777-89-1 | 08/02/2019 | |
4-methylpentan-2-one; isobutyl methyl ketone | 203-550-1 | 108-10-1 | 25/01/2019 | |
methyl salicylate | 204-317-7 | 119-36-8 | 25/01/2019 | |
[S-(Z,E)]-5-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid ; S-abscisic acid | 244-319-5 | 21293-29-8 | 11/01/2019 | |
emamectin benzoate (ISO); (4’’R)-4’’-deoxy-4’’-(methylamino)avermectin B1 benzoate | - | 155569-91-8 | 11/01/2019 | |
Trinexapac-ethyl (ISO); ethyl(1RS, 4EZ)4-[cyclopropyl(hydroxy)methylene]-3,5-dioxocyclohexanecarboxylate | - | 95266-40-3 | 11/01/2019 | |
3-aminomethyl-3,5,5-trimethylcyclohexylamine | 220-666-8 | 2855-13-2 | 07/12/2018 | |
6,6'-di-tert-butyl-2,2'-methylenedi-p-cresol | 204-327-1 | 119-47-1 | 07/12/2018 | |
Azamethiphos | 252-626-0 | 35575-96-3 | 07/12/2018 | |
diflufenican (ISO); N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]-3-pyridinecarboxamide; 2′,4′-difluoro-2-(α,α,α-trifluoro-m-tolyloxy) nicotinanilide | - | 83164-33-4 | 07/12/2018 | |
imidacloprid (ISO); (E)-1-(6-chloro-3-pyridylmethyl)-N-nitroimidazolidin-2-ylideneamine | - | 138261-41-3 | 07/12/2018 | |
mecoprop-P (ISO) [1] and its salts; (R)-2-(4-chloro-2-methylphenoxy)propionic acid [1] and its salts | 240-539-0 | 16484-77-8 | 07/12/2018 | |
tetrakis(2,6-dimethylphenyl)-m-phenylene biphosphate; tetrakis(2,6-dimethylphenyl) 1,3-phenylene bis(phosphate) | 432-770-2 | 139189-30-3 | 07/12/2018 | |
2-phenoxyethanol | 204-589-7 | 122-99-6 | 16/11/2018 | |
7-oxa-3-oxiranylbicyclo[4.1.0]heptane; 1,2-epoxy-4-epoxyethylcyclohexane; 4-vinylcyclohexene diepoxide | 203-437-7 | 106-87-6 | 19/10/2018 | |
2,2-dibromo-2-cyanoacetamide; [DBNPA] | 233-539-7 | 10222-01-2 | 18/09/2018 | |
Benzyl salicylate | 204-262-9 | 118-58-1 | 18/09/2018 | |
Tolclofos-methyl (ISO); O-(2,6-dichloro-p-tolyl) O,O-dimethyl thiophosphate | 260-515-3 | 57018-04-9 | 18/09/2018 | |
trinickel disulphide nickel subsulfide; [1] heazlewoodite [2] | 234-829-6 |
12035-72-2 12035-71-1 | 18/09/2018 | |
1,2,4-triazole | 206-022-9 | 288-88-0 | 03/08/2018 | |
N-{2-[[1,1'-bi(cyclopropyl)]-2-yl]phenyl}-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxamide; sedaxane | - | 874967-67-6 | 03/08/2018 | |
(R)-p-mentha-1,8-diene; d-limonene | 227-813-5 | 5989-27-5 | 20/07/2018 | |
1-isopropyl-4-methylbenzene; p-cymene | 202-796-7 | 99-87-6 | 20/07/2018 | |
p-mentha-1,3-diene; 1-isopropyl-4-methylcyclohexa-1,3-diene; alpha-terpinene | 202-795-1 | 99-86-5 | 20/07/2018 | |
(RS)-1-{1-ethyl-4-[4-mesyl-3-(2-methoxyethoxy)-o-toluoyl]pyrazol-5-yloxy}ethyl methyl carbonate; tolpyralate | - | 1101132-67-5 | 02/07/2018 | |
prothioconazole (ISO); 2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione | - | 178928-70-6 | 22/06/2018 | |
silthiofam (ISO); N-allyl-4,5-dimethyl-2-(trimethylsilyl)thiophene-3-carboxamide | - | 175217-20-6 | 22/06/2018 | |
thiophanate-methyl (ISO); dimethyl (1,2-phenylenedicarbamothioyl)biscarbamate; dimethyl 4,4′-(o-phenylene)bis(3-thioallophanate) | 245-740-7 | 23564-05-8 | 22/06/2018 | |
(5-chloro-2-methoxy-4-methyl-3-pyridyl)(4,5,6-trimethoxy-o-tolyl)methanone; pyriofenone | - | 688046-61-9 | 08/06/2018 | |
1,4-dioxane | 204-661-8 | 123-91-1 | 08/06/2018 | |
flumioxazin (ISO); N-(7-fluoro-3,4-dihydro-3-oxo-4-prop-2-ynyl-2H-1,4-benzoxazin-6-yl)cyclohex-1-ene-1,2-dicarboximide | - | 103361-09-7 | 08/06/2018 | |
N-methoxy-N-[1-methyl-2-(2,4,6-trichlorophenyl)-ethyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide; pydiflumetofen | - | 1228284-64-7 | 08/06/2018 | |
3-(difluoromethyl)-1-methyl-N-(3',4',5'-trifluorobiphenyl-2-yl)pyrazole-4-carboxamide; fluxapyroxad | - | 907204-31-3 | 11/05/2018 | |
m-bis(2,3-epoxypropoxy)benzene | 202-987-5 | 101-90-6 | 11/05/2018 | |
octhilinone (ISO); 2-octyl-2H-isothiazol-3-one; [OIT] | 247-761-7 | 26530-20-1 | 11/05/2018 | |
oxathiapiprolin (ISO); 1-(4-{4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl}piperidin-1-yl)-2-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]ethanone | - | 1003318-67-9 | 11/05/2018 | |
mancozeb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) complex with zinc salt | 616-995-5 | 8018-01-7 | 27/04/2018 | |
2,4-dinitrophenol | 200-087-7 | 51-28-5 | 13/04/2018 | |
2-(4-tert-butylbenzyl)propionaldehyde | 201-289-8 | 80-54-6 | 13/04/2018 | |
4,5-dichloro-2-octyl-2H-isothiazol-3-one (DCOIT) | 264-843-8 | 64359-81-5 | 13/04/2018 | |
dibenzo[def,p]chrysene;dibenzo[a,l]pyrene | 205-886-4 | 191-30-0 | 13/04/2018 | |
phosphine | 232-260-8 | 7803-51-2 | 13/04/2018 | |
pirimiphos-methyl (ISO); O-[2-(diethylamino)-6-methylpyrimidin-4-yl] O,O-dimethyl phosphorothioate | 249-528-5 | 29232-93-7 | 13/04/2018 | |
Iprovalicarb (ISO); isopropyl [(2S)-3-methyl-1-{[1-(4-methylphenyl)ethyl]amino}-1-oxobutan-2-yl]carbamate | - | 140923-17-7 | 19/03/2018 | |
2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate; [DOTE] | 239-622-4 | 15571-58-1 | 02/02/2018 | |
3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one | 262-661-3 | 61213-25-0 | 02/02/2018 | |
hexythiazox (ISO); trans-5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-3-thiazolidine-carboxamide | - | 78587-05-0 | 02/02/2018 | |
bis(N-hydroxy-N-nitrosocyclohexylaminato- O,O')copper; bis(N-cyclohexyl-diazenium- dioxy)-copper; [Cu-HDO] | 239-703-4 |
15627-09-5 312600-89-8 | 12/01/2018 | |
Hexyl 2-(1-(diethylaminohydroxyphenyl)methanoyl)benzoate; hexyl 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate | 443-860-6 | 302776-68-7 | 12/01/2018 | |
potassium (oxido-NNO-azoxy)cyclohexane; cyclohexylhydroxydiazene 1-oxide, potassium salt; [K-HDO] | - | 66603-10-9 | 12/01/2018 | |
thiencarbazone-methyl (ISO); methyl 4-[(4,5-dihydro-3-methoxy-4-methyl-5-oxo-1H-1,2,4-triazol-1-yl)carbonylsulfamoyl]-5- methylthiophene-3-carboxylate | - | 317815-83-1 | 12/01/2018 | |
2-butoxyethanol; ethylene glycol monobutyl ether | 203-905-0 | 111-76-2 | 01/12/2017 | |
5-fluoro-1,3-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-4-carboxamide; penflufen | - | 494793-67-8 | 01/12/2017 | |
citral | 226-394-6 | 5392-40-5 | 01/12/2017 | |
dioctyltin dilaurate; [1] stannane, dioctyl-, bis(coco acyloxy) derivs. [2] |
222-883-3 293-901-5 | 3648-18-8 91648-39-4 | 01/12/2017 | |
geraniol; (2E)-3,7-dimethylocta-2,6-dien-1-ol | 203-377-1 | 106-24-1 | 01/12/2017 | |
hymexazol (ISO); 3-hydroxy-5-methylisoxazole | 233-000-6 | 10004-44-1 | 01/12/2017 | |
mesotrione (ISO); 2-[4-(methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione | - | 104206-82-8 | 01/12/2017 | |
4-[(6-chloro-3-pyridylmethyl)(2,2-difluoroethyl)amino]furan-2(5H)-one; flupyradifurone | - | 951659-40-8 | 30/10/2017 | |
azoxystrobin (ISO); methyl (2E)-2-(2-{[6-(2-cyanophenoxy)pyrimidin-4-yl]oxy}phenyl)-3-methoxyacrylate | - | 131860-33-8 | 30/10/2017 | |
Bis(2-(2-methoxyethoxy)ethyl)ether; tetraglyme | 205-594-7 | 143-24-8 | 30/10/2017 | |
Dichlorodioctylstannane | 222-583-2 | 3542-36-7 | 30/10/2017 | |
lead | 231-100-4 | 7439-92-1 | 30/10/2017 | |
sodium N-(hydroxymethyl)glycinate; [formaldehyde released from sodium N-(hydroxymethyl)glycinate] | 274-357-8 | 70161-44-3 | 30/10/2017 | |
trimethoxy(methyl)silane | 214-685-0 | 1185-55-3 | 30/10/2017 | |
2-methyl-1,2-benzothiazol-3(2H)-one; [MBIT] | - | 2527-66-4 | 04/09/2017 | |
butanone oxime; ethyl methyl ketoxime; ethyl methyl ketone oxime | 202-496-6 | 96-29-7 | 04/09/2017 | |
glyoxylic acid …% | 206-058-5 | 298-12-4 | 04/09/2017 | |
pymetrozine (ISO); (E)-4,5-dihydro-6-methyl-4-(3-pyridylmethyleneamino)-1,2,4-triazin-3(2H)-one | - | 123312-89-0 | 04/09/2017 | |
tribenuron-methyl (ISO); methyl 2-[N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-N-methylcarbamoylsulfamoyl]benzoate | 401-190-1 | 101200-48-0 | 04/09/2017 | |
bis(α,α-dimethylbenzyl) peroxide | 201-279-3 | 80-43-3 | 04/08/2017 | |
N-(hydroxymethyl)acrylamide; methylolacrylamide; [NMA] | 213-103-2 | 924-42-5 | 04/08/2017 | |
trimethoxyvinylsilane; trimethoxy(vinyl)silane | 220-449-8 | 2768-02-7 | 04/08/2017 | |
tris(2-methoxyethoxy)vinylsilane; 6-(2-methoxyethoxy)-6-vinyl-2,5,7,10-tetraoxa-6-silaundecane | 213-934-0 | 1067-53-4 | 04/08/2017 | |
(2RS)-2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1-(1H-1,2,4-triazol-1-yl)propan-2-ol; mefentrifluconazole | - | 1417782-03-6 | 14/07/2017 | |
mecetronium etilsulfate; N-ethyl-N,N-dimethylhexadecan-1-aminium ethyl sulfate; Mecetronium ethyl sulphate [MES] | 221-106-5 | 3006-10-8 | 14/07/2017 | |
2,2-bis(bromomethyl)propane-1,3-diol | 221-967-7 | 3296-90-0 | 07/07/2017 | |
Dimethyl disulphide | 210-871-0 | 624-92-0 | 07/07/2017 | |
paclobutrazol (ISO); (2RS,3RS)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)-pentan-3-ol | - | 76738-62-0 | 07/07/2017 | |
pyrithione zinc; (T-4)-bis[1-(hydroxy-.kappa.O)pyridine-2(1H)-thionato-.kappa.S]zinc | 236-671-3 | 13463-41-7 | 07/07/2017 | |
nitric acid ... % | 231-714-2 | 7697-37-2 | 09/06/2017 | |
1,2-Benzenedicarboxylic acid, di-C8-10-branched alkylesters, C9-rich; [1] di-“isononyl” phthalate; [2] |
271-090-9 249-079-5 | 68515-48-0 28553-12-0 | 19/05/2017 | |
ethofumesate (ISO) (±)-2-ethoxy-2,3-dihydro-3,3-dimethylbenzofuran-5-yl methanesulfonate | 247-525-3 | 26225-79-6 | 19/05/2017 | |
Granulated copper | 231-159-6 | 7440-50-8 | 19/05/2017 | |
2-methoxyethyl acrylate | 221-499-3 | 3121-61-7 | 28/04/2017 | |
branched hexatriacontane | 417-070-7 | 151006-62-1 | 28/04/2017 | |
diisooctyl phthalate | 248-523-5 | 27554-26-3 | 28/04/2017 | |
imiprothrin (ISO); reaction mass of: [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-cis-chrysanthemate; [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-trans-chrysanthemate | 428-790-6 | 72963-72-5 | 28/04/2017 | |
ipconazole (ISO); (1RS,2SR,5RS;1RS,2SR,5SR)-2-(4-chlorobenzyl)-5-isopropyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol (CAS No 125225-28-7, all stereoisomers; 115850-69-6, cis-cis racemate; 115937-89-8, cist-trans racemate) | - |
125225-28-7 115850-69-6 115937-89-8 | 28/04/2017 | |
L-(+)-lactic acid; (2S)-2-hydroxypropanoic acid | 201-196-2 | 79-33-4 | 28/04/2017 | |
Margosa, ext. [cold-pressed oil of Azadirachta indica seeds without shells extracted with super-critical carbon dioxide] | 283-644-7 | 84696-25-3 | 28/04/2017 | |
silicon carbide (fibres fulfilling the WHO definition: diameter <3 µm, length > 5 µm and aspect ratio ≥ 3:1) | - | - | 28/04/2017 | |
Ethanol, 2,2'-iminobis-, N-(C13-15-branched and linear alkyl) derivs. | 308-208-6 | 97925-95-6 | 25/04/2017 | |
Categories Display
Route: .live2