Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
but-2-enedioic acid


EC number:
EC name:
Maleic acid
CAS number:
CAS number:
(Z)-buten​edioic ac​id
1,2-Ethylenedicarboxylic acid, (Z)
2-Butenedioic acid (2Z)-
2-Butenedioic acid (Z)-
cis-Butenedioic acid
CAS number
IUPAC name
(2Z)-But-2-enedioic acid
IUPAC name
(2Z)-but-2-enedioic acid
IUPAC name
(Z)-but-2-enedioic acid
IUPAC name
but-2-enedioic acid
other: InChl
other: SMILES notation
other: InChl
other: InChl
InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1- AuxInfo=1/1/N:3,4,2,1,6,8,5,7/E:(1,2)(3,4)(5,6,7,8)/gE:(1,2)/rA:8CCCCOOOO/rB:;s2;s1d-3;d1;d2;s1;s2;/rC:4.6439,-1.3259,0;1.5419,-1.3259,0;2.3065,0,0;3.8606,0,0;3.8606,-2.6271,0;2.3065,-2.6271,0;6.1609,-1.3136,0;0,-1.3569,0;
other: SMILES notation
other: SMILES notation
other: SMILES notation
but-2-enedioic acid

Molecular and structural information

Molecular formula:
Molecular weight:
SMILES notation:
Structural formula:
Chemical structure

Related substances