Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
Reaction Mass of 3,3-diphenylhexamethyltrisiloxane and 3,3,5,5-tetraphenylhexamethyltetrasiloxane


EC number:
EC name:
CAS number:
CAS number:


Molecular and structural information

Molecular formula:
Constituent 1: C18H28O2Si3

Constituent 2: C30H38O3Si4
Molecular weight:
ca. 360.68 - ca. 558.98
SMILES notation:
Constituent 1 - C[Si](O[Si](c1ccccc1)(c1ccccc1)O[Si](C)(C)C)(C)C

Constituent 2 - C[Si](O[Si](c1ccccc1)(c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)O[Si](C)(C)C)(C)C
Structural formula:
Chemical structure

Related substances

Categories Display